C21H29NO4 — CID 176774593
methyl (2Z,4E)-5-[(1S)-2-[(1Z,3E)-4-(dimethylamino)buta-1,3-dienyl]-1-hydroxy-6,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoate (PubChem CID 176774593) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is methyl (2Z,4E)-5-[(1S)-2-[(1Z,3E)-4-(dimethylamino)buta-1,3-dienyl]-1-hydroxy-6,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-5-[(1S)-2-[(1Z,3E)-4-(dimethylamino)buta-1,3-dienyl]-1-hydroxy-6,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 176774593 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | methyl (2Z,4E)-5-[(1S)-2-[(1Z,3E)-4-(dimethylamino)buta-1,3-dienyl]-1-hydroxy-6,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoate |
| SMILES | COC(=O)/C=C(C)\C=C\[C@@]1(O)C(/C=C\C=C\N(C)C)=CC(=O)CC1(C)C |
| InChI | InChI=1S/C21H29NO4/c1-16(13-19(24)26-6)10-11-21(25)17(9-7-8-12-22(4)5)14-18(23)15-20(21,2)3/h7-14,25H,15H2,1-6H3/b9-7-,11-10+,12-8+,16-13-/t21-/m1/s1 |
| InChIKey | OFBUOGYUIMWPNR-FALWTYMYSA-N |
| XLogP | 2.95 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|