About heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate
heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate (PubChem CID 176774614) has the molecular formula C35H66O7
and a molecular weight of 598.91 g/mol. Its IUPAC name is heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate.
Molecular Properties
| Compound Name | heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate |
| PubChem CID | 176774614 |
| Molecular Formula | C35H66O7 |
| Molecular Weight | 598.91 g/mol |
| Exact Mass | 598.48 |
| IUPAC Name | heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCOC(=O)C(C)(COC(=O)C(C)C)COC(C)C |
| InChI | InChI=1S/C35H66O7/c1-8-10-12-14-16-19-23-31(24-20-17-15-13-11-9-2)42-32(36)25-21-18-22-26-39-34(38)35(7,27-40-30(5)6)28-41-33(37)29(3)4/h29-31H,8-28H2,1-7H3 |
| InChIKey | PLISOEXWNIUBPZ-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 598.91 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate?
The IUPAC name of heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate (CID 176774614) is heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate.
What is the SMILES notation for heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate?
The canonical SMILES for heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate is CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCOC(=O)C(C)(COC(=O)C(C)C)COC(C)C.
What is the InChIKey of heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate?
The InChIKey is PLISOEXWNIUBPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H66O7/c1-8-10-12-14-16-19-23-31(24-20-17-15-13-11-9-2)42-32(36)25-21-18-22-26-39-34(38)35(7,27-40-30(5)6)28-41-33(37)29(3)4/h29-31H,8-28H2,1-7H3.
What are the key properties of heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate?
heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate has a molecular weight of 598.91 g/mol, XLogP of 9.13, 28 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for heptadecan-9-yl 6-[2-methyl-2-(2-methylpropanoyloxymethyl)-3-propan-2-yloxypropanoyl]oxyhexanoate is sourced from PubChem (CID 176774614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).