C43H27N3O — CID 176775317
2-(1,3,4,5,7,8-hexadeuterio-6-phenylnaphthalen-2-yl)-4-phenyl-6-[2,3,4-trideuterio-5-(2,3,4,6,7,8-hexadeuteriodibenzofuran-1-yl)phenyl]-1,3,5-triazine (PubChem CID 176775317) has the molecular formula C43H27N3O and a molecular weight of 616.80 g/mol. Its IUPAC name is 2-(1,3,4,5,7,8-hexadeuterio-6-phenylnaphthalen-2-yl)-4-phenyl-6-[2,3,4-trideuterio-5-(2,3,4,6,7,8-hexadeuteriodibenzofuran-1-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(1,3,4,5,7,8-hexadeuterio-6-phenylnaphthalen-2-yl)-4-phenyl-6-[2,3,4-trideuterio-5-(2,3,4,6,7,8-hexadeuteriodibenzofuran-1-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176775317 |
| Molecular Formula | C43H27N3O |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | 2-(1,3,4,5,7,8-hexadeuterio-6-phenylnaphthalen-2-yl)-4-phenyl-6-[2,3,4-trideuterio-5-(2,3,4,6,7,8-hexadeuteriodibenzofuran-1-yl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1cc2c(oc3c([2H])c([2H])c([2H])c(-c4cc(-c5nc(-c6ccccc6)nc(-c6c([2H])c([2H])c7c([2H])c(-c8ccccc8)c([2H])c([2H])c7c6[2H])n5)c([2H])c([2H])c4[2H])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C43H27N3O/c1-3-11-28(12-4-1)30-21-22-32-26-35(24-23-31(32)25-30)43-45-41(29-13-5-2-6-14-29)44-42(46-43)34-16-9-15-33(27-34)36-18-10-20-39-40(36)37-17-7-8-19-38(37)47-39/h1-27H/i7D,8D,9D,10D,15D,16D,18D,19D,20D,21D,22D,23D,24D,25D,26D |
| InChIKey | MJFDGRYBFBDCJF-ONKDWCRYSA-N |
| XLogP | 11.26 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |