C47H32O — CID 176777627
6-[9,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)fluoren-1-yl]-11-naphthalen-2-ylnaphtho[2,3-b][1]benzofuran (PubChem CID 176777627) has the molecular formula C47H32O and a molecular weight of 617.80 g/mol. Its IUPAC name is 6-[9,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)fluoren-1-yl]-11-naphthalen-2-ylnaphtho[2,3-b][1]benzofuran.
| Compound Name | 6-[9,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)fluoren-1-yl]-11-naphthalen-2-ylnaphtho[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 176777627 |
| Molecular Formula | C47H32O |
| Molecular Weight | 617.80 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | 6-[9,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)fluoren-1-yl]-11-naphthalen-2-ylnaphtho[2,3-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3c4ccccc4c(-c4ccc5ccccc5c4)c4c3oc3ccccc34)c3c2-c2ccccc2C3(C)C)c([2H])c1[2H] |
| InChI | InChI=1S/C47H32O/c1-47(2)39-22-12-10-20-36(39)42-33(30-15-4-3-5-16-30)26-27-38(45(42)47)43-35-19-9-8-18-34(35)41(32-25-24-29-14-6-7-17-31(29)28-32)44-37-21-11-13-23-40(37)48-46(43)44/h3-28H,1-2H3/i3D,4D,5D,15D,16D |
| InChIKey | DELKIFLQKOIOGG-LKBVHHDISA-N |
| XLogP | 13.20 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.80 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |