C49H32O — CID 170657945
6-(9,9-dimethylfluoren-3-yl)-1-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]dibenzofuran (PubChem CID 170657945) has the molecular formula C49H32O and a molecular weight of 641.82 g/mol. Its IUPAC name is 6-(9,9-dimethylfluoren-3-yl)-1-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]dibenzofuran.
| Compound Name | 6-(9,9-dimethylfluoren-3-yl)-1-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]dibenzofuran |
|---|---|
| PubChem CID | 170657945 |
| Molecular Formula | C49H32O |
| Molecular Weight | 641.82 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 6-(9,9-dimethylfluoren-3-yl)-1-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3ccc4c(-c5cccc6oc7c(-c8ccc9c(c8)-c8ccccc8C9(C)C)cccc7c56)ccc5ccc2c3c54)c([2H])c1[2H] |
| InChI | InChI=1S/C49H32O/c1-49(2)42-16-7-6-12-36(42)41-28-32(22-27-43(41)49)34-13-8-15-40-47-37(14-9-17-44(47)50-48(34)40)35-24-19-31-20-25-38-33(29-10-4-3-5-11-29)23-18-30-21-26-39(35)46(31)45(30)38/h3-28H,1-2H3/i3D,4D,5D,10D,11D |
| InChIKey | JADKWLBMZRGMIX-XUGOROQDSA-N |
| XLogP | 13.79 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.82 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|