C70H50 — CID 156675158
1,6-bis(9,9-dimethylfluoren-3-yl)-3,8-bis[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrene (PubChem CID 156675158) has the molecular formula C70H50 and a molecular weight of 901.23 g/mol. Its IUPAC name is 1,6-bis(9,9-dimethylfluoren-3-yl)-3,8-bis[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrene.
| Compound Name | 1,6-bis(9,9-dimethylfluoren-3-yl)-3,8-bis[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrene |
|---|---|
| PubChem CID | 156675158 |
| Molecular Formula | C70H50 |
| Molecular Weight | 901.23 g/mol |
| Exact Mass | 900.45 |
| IUPAC Name | 1,6-bis(9,9-dimethylfluoren-3-yl)-3,8-bis[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3cc(-c4ccc5c(c4)-c4ccccc4C5(C)C)c4ccc5c(-c6ccc(-c7c([2H])c([2H])c([2H])c([2H])c7[2H])cc6)cc(-c6ccc7c(c6)-c6ccccc6C7(C)C)c6ccc3c4c56)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C70H50/c1-69(2)63-21-13-11-19-51(63)61-39-49(31-37-65(61)69)59-41-57(47-27-23-45(24-28-47)43-15-7-5-8-16-43)53-34-36-56-60(50-32-38-66-62(40-50)52-20-12-14-22-64(52)70(66,3)4)42-58(54-33-35-55(59)67(53)68(54)56)48-29-25-46(26-30-48)44-17-9-6-10-18-44/h5-42H,1-4H3/i5D,6D,7D,8D,9D,10D,15D,16D,17D,18D |
| InChIKey | ADWHVLCFZMQCAE-GFOJEWNTSA-N |
| XLogP | 19.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.23 |
| LogP ≤ 5 | 19.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|