C46H34 — CID 169035287
10,10,12,12-tetramethyl-7-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]indeno[2,1-b]fluorene (PubChem CID 169035287) has the molecular formula C46H34 and a molecular weight of 591.81 g/mol. Its IUPAC name is 10,10,12,12-tetramethyl-7-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]indeno[2,1-b]fluorene.
| Compound Name | 10,10,12,12-tetramethyl-7-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]indeno[2,1-b]fluorene |
|---|---|
| PubChem CID | 169035287 |
| Molecular Formula | C46H34 |
| Molecular Weight | 591.81 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | 10,10,12,12-tetramethyl-7-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]indeno[2,1-b]fluorene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3ccc4c(-c5ccc6c(c5)-c5cc7c(cc5C6(C)C)C(C)(C)c5ccccc5-7)ccc5ccc2c3c54)c([2H])c1[2H] |
| InChI | InChI=1S/C46H34/c1-45(2)39-13-9-8-12-33(39)37-25-38-36-24-30(18-23-40(36)46(3,4)42(38)26-41(37)45)32-20-15-29-16-21-34-31(27-10-6-5-7-11-27)19-14-28-17-22-35(32)44(29)43(28)34/h5-26H,1-4H3/i5D,6D,7D,10D,11D |
| InChIKey | WBEFOGCYNRWTCC-HCNOYMLYSA-N |
| XLogP | 12.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.81 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|