C43H28O — CID 169035210
14,14-dimethyl-7-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]-9-oxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene (PubChem CID 169035210) has the molecular formula C43H28O and a molecular weight of 565.73 g/mol. Its IUPAC name is 14,14-dimethyl-7-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]-9-oxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene.
| Compound Name | 14,14-dimethyl-7-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]-9-oxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 169035210 |
| Molecular Formula | C43H28O |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | 14,14-dimethyl-7-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]-9-oxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3ccc4c(-c5cccc6c5oc5ccc7c(c56)-c5ccccc5C7(C)C)ccc5ccc2c3c54)c([2H])c1[2H] |
| InChI | InChI=1S/C43H28O/c1-43(2)35-14-7-6-11-33(35)40-36(43)23-24-37-41(40)34-13-8-12-32(42(34)44-37)29-20-16-27-17-21-30-28(25-9-4-3-5-10-25)19-15-26-18-22-31(29)39(27)38(26)30/h3-24H,1-2H3/i3D,4D,5D,9D,10D |
| InChIKey | UBSCVLFGISNBAY-GGXSZSEQSA-N |
| XLogP | 12.12 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|