C49H34 — CID 171045485
12-(7,7-dimethylbenzo[a]phenalen-4-yl)-4,7-bis(2,3,4,5,6-pentadeuteriophenyl)benzo[a]anthracene (PubChem CID 171045485) has the molecular formula C49H34 and a molecular weight of 632.87 g/mol. Its IUPAC name is 12-(7,7-dimethylbenzo[a]phenalen-4-yl)-4,7-bis(2,3,4,5,6-pentadeuteriophenyl)benzo[a]anthracene.
| Compound Name | 12-(7,7-dimethylbenzo[a]phenalen-4-yl)-4,7-bis(2,3,4,5,6-pentadeuteriophenyl)benzo[a]anthracene |
|---|---|
| PubChem CID | 171045485 |
| Molecular Formula | C49H34 |
| Molecular Weight | 632.87 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | 12-(7,7-dimethylbenzo[a]phenalen-4-yl)-4,7-bis(2,3,4,5,6-pentadeuteriophenyl)benzo[a]anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2ccc2c(-c4c([2H])c([2H])c([2H])c([2H])c4[2H])c4ccccc4c(-c4ccc5c6c(cccc46)-c4ccccc4C5(C)C)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C49H34/c1-49(2)43-26-12-11-19-35(43)37-24-14-25-39-41(29-30-44(49)46(37)39)47-40-21-10-9-20-38(40)45(32-17-7-4-8-18-32)42-28-27-34-33(31-15-5-3-6-16-31)22-13-23-36(34)48(42)47/h3-30H,1-2H3/i3D,4D,5D,6D,7D,8D,15D,16D,17D,18D |
| InChIKey | JPJVOUNPBMPDCH-DURQZGORSA-N |
| XLogP | 13.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.87 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|