C23H32FN5O — CID 176778545
(4S,7R)-14,18-ditert-butyl-15-fluoro-11-oxa-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12,14,16(20),17-pentaene (PubChem CID 176778545) has the molecular formula C23H32FN5O and a molecular weight of 413.54 g/mol. Its IUPAC name is (4S,7R)-14,18-ditert-butyl-15-fluoro-11-oxa-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12,14,16(20),17-pentaene.
| Compound Name | (4S,7R)-14,18-ditert-butyl-15-fluoro-11-oxa-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12,14,16(20),17-pentaene |
|---|---|
| PubChem CID | 176778545 |
| Molecular Formula | C23H32FN5O |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | (4S,7R)-14,18-ditert-butyl-15-fluoro-11-oxa-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12,14,16(20),17-pentaene |
| SMILES | CC(C)(C)c1nc2c3c(nc(C(C)(C)C)c(F)c3n1)OCCC1[C@H]3CC[C@@H](CN21)N3 |
| InChI | InChI=1S/C23H32FN5O/c1-22(2,3)18-16(24)17-15-19(28-21(26-17)23(4,5)6)29-11-12-7-8-13(25-12)14(29)9-10-30-20(15)27-18/h12-14,25H,7-11H2,1-6H3/t12-,13+,14?/m0/s1 |
| InChIKey | FNGYOFPXYYYRRE-WLDKUNSKSA-N |
| XLogP | 3.85 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |