C16H24N4 — CID 176779972
(E)-3-amino-2-(5-isocyano-4-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridin-2-yl)-4-methylpent-2-enenitrile (PubChem CID 176779972) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is (E)-3-amino-2-(5-isocyano-4-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridin-2-yl)-4-methylpent-2-enenitrile.
| Compound Name | (E)-3-amino-2-(5-isocyano-4-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridin-2-yl)-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 176779972 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (E)-3-amino-2-(5-isocyano-4-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridin-2-yl)-4-methylpent-2-enenitrile |
| SMILES | [C-]#[N+]C1=C(C(C)C)NC(/C(C#N)=C(\N)C(C)C)CC1C |
| InChI | InChI=1S/C16H24N4/c1-9(2)14(18)12(8-17)13-7-11(5)16(19-6)15(20-13)10(3)4/h9-11,13,20H,7,18H2,1-5H3/b14-12- |
| InChIKey | NKSWSEZFJDASET-OWBHPGMISA-N |
| XLogP | 3.16 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|