C59H37N — CID 176780548
12-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-7,7-diphenylindeno[1,2-a]carbazole (PubChem CID 176780548) has the molecular formula C59H37N and a molecular weight of 764.98 g/mol. Its IUPAC name is 12-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-7,7-diphenylindeno[1,2-a]carbazole.
| Compound Name | 12-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-7,7-diphenylindeno[1,2-a]carbazole |
|---|---|
| PubChem CID | 176780548 |
| Molecular Formula | C59H37N |
| Molecular Weight | 764.98 g/mol |
| Exact Mass | 764.32 |
| IUPAC Name | 12-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-7,7-diphenylindeno[1,2-a]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3ccc4c(-c5cccc(-n6c7ccccc7c7ccc8c(c76)-c6ccccc6C8(c6ccccc6)c6ccccc6)c5)ccc5ccc2c3c54)c([2H])c1[2H] |
| InChI | InChI=1S/C59H37N/c1-4-15-38(16-5-1)45-31-27-39-30-34-49-46(32-28-40-29-33-48(45)55(39)56(40)49)41-17-14-22-44(37-41)60-54-26-13-11-23-47(54)50-35-36-53-57(58(50)60)51-24-10-12-25-52(51)59(53,42-18-6-2-7-19-42)43-20-8-3-9-21-43/h1-37H/i1D,4D,5D,15D,16D |
| InChIKey | ZXTTVAZLJNKMBF-KTZHZIRUSA-N |
| XLogP | 15.38 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.98 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|