C14H16F2N4O2 — CID 176780665
1-(difluoromethyl)-N'-(3-methoxy-2,6-dimethylphenyl)pyrazole-3-carbohydrazide (PubChem CID 176780665) has the molecular formula C14H16F2N4O2 and a molecular weight of 310.30 g/mol. Its IUPAC name is 1-(difluoromethyl)-N'-(3-methoxy-2,6-dimethylphenyl)pyrazole-3-carbohydrazide.
| Compound Name | 1-(difluoromethyl)-N'-(3-methoxy-2,6-dimethylphenyl)pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 176780665 |
| Molecular Formula | C14H16F2N4O2 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-(difluoromethyl)-N'-(3-methoxy-2,6-dimethylphenyl)pyrazole-3-carbohydrazide |
| SMILES | COc1ccc(C)c(NNC(=O)c2ccn(C(F)F)n2)c1C |
| InChI | InChI=1S/C14H16F2N4O2/c1-8-4-5-11(22-3)9(2)12(8)17-18-13(21)10-6-7-20(19-10)14(15)16/h4-7,14,17H,1-3H3,(H,18,21) |
| InChIKey | NKPXVHYTJFNLHN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|