C52H43N4OPtS-3 — CID 176782644
2-[3-(3-tert-butyl-4,5-diphenyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-12-(4-tert-butyl-2-pyridinyl)-1H-[1]benzothiolo[2,3-a]carbazol-1-ide;platinum (PubChem CID 176782644) has the molecular formula C52H43N4OPtS-3 and a molecular weight of 967.09 g/mol. Its IUPAC name is 2-[3-(3-tert-butyl-4,5-diphenyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-12-(4-tert-butyl-2-pyridinyl)-1H-[1]benzothiolo[2,3-a]carbazol-1-ide;platinum.
| Compound Name | 2-[3-(3-tert-butyl-4,5-diphenyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-12-(4-tert-butyl-2-pyridinyl)-1H-[1]benzothiolo[2,3-a]carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 176782644 |
| Molecular Formula | C52H43N4OPtS-3 |
| Molecular Weight | 967.09 g/mol |
| Exact Mass | 966.28 |
| IUPAC Name | 2-[3-(3-tert-butyl-4,5-diphenyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-12-(4-tert-butyl-2-pyridinyl)-1H-[1]benzothiolo[2,3-a]carbazol-1-ide;platinum |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(N5[CH-]N(C(C)(C)C)C(c6ccccc6)=C5c5ccccc5)ccc4)ccc3c3ccc4c5ccccc5sc4c32)c1.[Pt] |
| InChI | InChI=1S/C52H43N4OS.Pt/c1-51(2,3)36-28-29-53-46(30-36)56-44-32-39(24-25-40(44)42-26-27-43-41-22-13-14-23-45(41)58-50(43)49(42)56)57-38-21-15-20-37(31-38)54-33-55(52(4,5)6)48(35-18-11-8-12-19-35)47(54)34-16-9-7-10-17-34;/h7-30,33H,1-6H3;/q-3; |
| InChIKey | ZHNSOJADXNAFRE-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.09 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|