C56H58N11O7Se — CID 176784769
CID 176784769 (PubChem CID 176784769) has the molecular formula C56H58N11O7Se and a molecular weight of 1076.11 g/mol.
| Compound Name | CID 176784769 |
|---|---|
| PubChem CID | 176784769 |
| Molecular Formula | C56H58N11O7Se |
| Molecular Weight | 1076.11 g/mol |
| Exact Mass | 1076.37 |
| IUPAC Name | — |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1Cc1ccc(NC(=O)OCc2ccc(NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)OCC3c4ccccc4-c4ccccc43)C(C)C)cc2COCc2cn([Se])nn2)cc1 |
| InChI | InChI=1S/C56H58N11O7Se/c1-5-6-19-48-62-50-51(45-17-11-12-18-47(45)61-52(50)57)66(48)27-35-20-23-38(24-21-35)60-55(70)73-30-36-22-25-39(26-37(36)29-72-31-40-28-67(75)65-64-40)59-53(68)34(4)58-54(69)49(33(2)3)63-56(71)74-32-46-43-15-9-7-13-41(43)42-14-8-10-16-44(42)46/h7-18,20-26,28,33-34,46,49H,5-6,19,27,29-32H2,1-4H3,(H2,57,61)(H,58,69)(H,59,68)(H,60,70)(H,63,71)/t34-,49-/m0/s1 |
| InChIKey | MFNUWGIJBZOZJS-KNFQSGROSA-N |
| XLogP | 8.55 |
| TPSA | 231.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1076.11 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|