C36H21FN6 — CID 176785275
2-[3-(2,4-dipyridin-2-ylquinazolin-8-yl)phenyl]-9-fluoro-1,10-phenanthroline (PubChem CID 176785275) has the molecular formula C36H21FN6 and a molecular weight of 556.60 g/mol. Its IUPAC name is 2-[3-(2,4-dipyridin-2-ylquinazolin-8-yl)phenyl]-9-fluoro-1,10-phenanthroline.
| Compound Name | 2-[3-(2,4-dipyridin-2-ylquinazolin-8-yl)phenyl]-9-fluoro-1,10-phenanthroline |
|---|---|
| PubChem CID | 176785275 |
| Molecular Formula | C36H21FN6 |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 2-[3-(2,4-dipyridin-2-ylquinazolin-8-yl)phenyl]-9-fluoro-1,10-phenanthroline |
| SMILES | Fc1ccc2ccc3ccc(-c4cccc(-c5cccc6c(-c7ccccn7)nc(-c7ccccn7)nc56)c4)nc3c2n1 |
| InChI | InChI=1S/C36H21FN6/c37-31-18-16-23-14-13-22-15-17-28(40-32(22)33(23)41-31)25-8-5-7-24(21-25)26-9-6-10-27-34(26)42-36(30-12-2-4-20-39-30)43-35(27)29-11-1-3-19-38-29/h1-21H |
| InChIKey | FNOQDGQJCUONMD-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|