C12H22F2N2O2 — CID 176787150
N-(difluoromethyl)-3-hydroxy-N,1-di(propan-2-yl)pyrrolidine-3-carboxamide (PubChem CID 176787150) has the molecular formula C12H22F2N2O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(difluoromethyl)-3-hydroxy-N,1-di(propan-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | N-(difluoromethyl)-3-hydroxy-N,1-di(propan-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 176787150 |
| Molecular Formula | C12H22F2N2O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-(difluoromethyl)-3-hydroxy-N,1-di(propan-2-yl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)N1CCC(O)(C(=O)N(C(C)C)C(F)F)C1 |
| InChI | InChI=1S/C12H22F2N2O2/c1-8(2)15-6-5-12(18,7-15)10(17)16(9(3)4)11(13)14/h8-9,11,18H,5-7H2,1-4H3 |
| InChIKey | RTMATNCOUYCQOI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|