C33H24N5O+ — CID 176787645
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-methyl-7-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 176787645) has the molecular formula C33H24N5O+ and a molecular weight of 506.59 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-methyl-7-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-methyl-7-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 176787645 |
| Molecular Formula | C33H24N5O+ |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-methyl-7-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1cc2c(cc1-c1cccc[n+]1C)oc1nc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc12 |
| InChI | InChI=1S/C33H24N5O/c1-21-19-26-24-16-17-27(34-33(24)39-29(26)20-25(21)28-15-9-10-18-38(28)2)32-36-30(22-11-5-3-6-12-22)35-31(37-32)23-13-7-4-8-14-23/h3-20H,1-2H3/q+1 |
| InChIKey | IPHIBWYFRZTOCK-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 68.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|