C51H51N3O5 — CID 176788593
N-[2-methoxy-5-(4-phenylpiperidin-1-yl)phenyl]-4-[4-[[4-[1-(4-methylbenzoyl)piperidin-4-yl]oxyphenyl]methoxy]phenyl]benzamide (PubChem CID 176788593) has the molecular formula C51H51N3O5 and a molecular weight of 785.99 g/mol. Its IUPAC name is N-[2-methoxy-5-(4-phenylpiperidin-1-yl)phenyl]-4-[4-[[4-[1-(4-methylbenzoyl)piperidin-4-yl]oxyphenyl]methoxy]phenyl]benzamide.
| Compound Name | N-[2-methoxy-5-(4-phenylpiperidin-1-yl)phenyl]-4-[4-[[4-[1-(4-methylbenzoyl)piperidin-4-yl]oxyphenyl]methoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 176788593 |
| Molecular Formula | C51H51N3O5 |
| Molecular Weight | 785.99 g/mol |
| Exact Mass | 785.38 |
| IUPAC Name | N-[2-methoxy-5-(4-phenylpiperidin-1-yl)phenyl]-4-[4-[[4-[1-(4-methylbenzoyl)piperidin-4-yl]oxyphenyl]methoxy]phenyl]benzamide |
| SMILES | COc1ccc(N2CCC(c3ccccc3)CC2)cc1NC(=O)c1ccc(-c2ccc(OCc3ccc(OC4CCN(C(=O)c5ccc(C)cc5)CC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C51H51N3O5/c1-36-8-12-43(13-9-36)51(56)54-32-28-47(29-33-54)59-46-21-10-37(11-22-46)35-58-45-23-18-40(19-24-45)39-14-16-42(17-15-39)50(55)52-48-34-44(20-25-49(48)57-2)53-30-26-41(27-31-53)38-6-4-3-5-7-38/h3-25,34,41,47H,26-33,35H2,1-2H3,(H,52,55) |
| InChIKey | ZNGONTGBKBLFHC-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.99 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|