C32H37BN2O4 — CID 176788834
ethyl 3-[5-(2,6-dimethylphenyl)-6-ethynyl-3-pyridinyl]-3-[[(2S)-4-methyl-2-(4-methyl-2-oxoborinin-1-yl)pentanoyl]amino]propanoate (PubChem CID 176788834) has the molecular formula C32H37BN2O4 and a molecular weight of 524.47 g/mol. Its IUPAC name is ethyl 3-[5-(2,6-dimethylphenyl)-6-ethynyl-3-pyridinyl]-3-[[(2S)-4-methyl-2-(4-methyl-2-oxoborinin-1-yl)pentanoyl]amino]propanoate.
| Compound Name | ethyl 3-[5-(2,6-dimethylphenyl)-6-ethynyl-3-pyridinyl]-3-[[(2S)-4-methyl-2-(4-methyl-2-oxoborinin-1-yl)pentanoyl]amino]propanoate |
|---|---|
| PubChem CID | 176788834 |
| Molecular Formula | C32H37BN2O4 |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | ethyl 3-[5-(2,6-dimethylphenyl)-6-ethynyl-3-pyridinyl]-3-[[(2S)-4-methyl-2-(4-methyl-2-oxoborinin-1-yl)pentanoyl]amino]propanoate |
| SMILES | C#Cc1ncc(C(CC(=O)OCC)NC(=O)C(CC(C)C)B2C=CC(C)=CC2=O)cc1-c1c(C)cccc1C |
| InChI | InChI=1S/C32H37BN2O4/c1-8-27-25(31-22(6)11-10-12-23(31)7)17-24(19-34-27)28(18-30(37)39-9-2)35-32(38)26(15-20(3)4)33-14-13-21(5)16-29(33)36/h1,10-14,16-17,19-20,26,28H,9,15,18H2,2-7H3,(H,35,38) |
| InChIKey | ODAYXVQWGKUFRS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|