C43H73NO10 — CID 176790363
[3-[2-[4-(2,5-dioxopyrrol-1-yl)-2-oxobutanoyl]oxyethoxy]-2-(11-ethyltridecanoyloxy)propyl] 11-ethyltridecanoate (PubChem CID 176790363) has the molecular formula C43H73NO10 and a molecular weight of 764.05 g/mol. Its IUPAC name is [3-[2-[4-(2,5-dioxopyrrol-1-yl)-2-oxobutanoyl]oxyethoxy]-2-(11-ethyltridecanoyloxy)propyl] 11-ethyltridecanoate.
| Compound Name | [3-[2-[4-(2,5-dioxopyrrol-1-yl)-2-oxobutanoyl]oxyethoxy]-2-(11-ethyltridecanoyloxy)propyl] 11-ethyltridecanoate |
|---|---|
| PubChem CID | 176790363 |
| Molecular Formula | C43H73NO10 |
| Molecular Weight | 764.05 g/mol |
| Exact Mass | 763.52 |
| IUPAC Name | [3-[2-[4-(2,5-dioxopyrrol-1-yl)-2-oxobutanoyl]oxyethoxy]-2-(11-ethyltridecanoyloxy)propyl] 11-ethyltridecanoate |
| SMILES | CCC(CC)CCCCCCCCCC(=O)OCC(COCCOC(=O)C(=O)CCN1C(=O)C=CC1=O)OC(=O)CCCCCCCCCC(CC)CC |
| InChI | InChI=1S/C43H73NO10/c1-5-35(6-2)23-19-15-11-9-13-17-21-25-41(48)53-34-37(54-42(49)26-22-18-14-10-12-16-20-24-36(7-3)8-4)33-51-31-32-52-43(50)38(45)29-30-44-39(46)27-28-40(44)47/h27-28,35-37H,5-26,29-34H2,1-4H3 |
| InChIKey | WPFVHTSRZADKTR-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.05 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|