C20H21ClN4O2 — CID 176791178
6-(6-chloro-3-methylindazol-1-yl)-N-(4-hydroxycyclohexyl)pyridine-3-carboxamide (PubChem CID 176791178) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 6-(6-chloro-3-methylindazol-1-yl)-N-(4-hydroxycyclohexyl)pyridine-3-carboxamide.
| Compound Name | 6-(6-chloro-3-methylindazol-1-yl)-N-(4-hydroxycyclohexyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 176791178 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 6-(6-chloro-3-methylindazol-1-yl)-N-(4-hydroxycyclohexyl)pyridine-3-carboxamide |
| SMILES | Cc1nn(-c2ccc(C(=O)NC3CCC(O)CC3)cn2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C20H21ClN4O2/c1-12-17-8-3-14(21)10-18(17)25(24-12)19-9-2-13(11-22-19)20(27)23-15-4-6-16(26)7-5-15/h2-3,8-11,15-16,26H,4-7H2,1H3,(H,23,27) |
| InChIKey | BMVDYMBCERSCDQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |