C58H38N2O — CID 176796154
5-(9-phenylcarbazol-4-yl)-N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphtho[2,1-b][1]benzofuran-9-amine (PubChem CID 176796154) has the molecular formula C58H38N2O and a molecular weight of 788.01 g/mol. Its IUPAC name is 5-(9-phenylcarbazol-4-yl)-N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphtho[2,1-b][1]benzofuran-9-amine.
| Compound Name | 5-(9-phenylcarbazol-4-yl)-N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphtho[2,1-b][1]benzofuran-9-amine |
|---|---|
| PubChem CID | 176796154 |
| Molecular Formula | C58H38N2O |
| Molecular Weight | 788.01 g/mol |
| Exact Mass | 787.35 |
| IUPAC Name | 5-(9-phenylcarbazol-4-yl)-N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphtho[2,1-b][1]benzofuran-9-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)oc3cc(-c5cccc6c5c5ccccc5n6-c5ccccc5)c5ccccc5c34)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C58H38N2O/c1-4-15-39(16-5-1)41-27-31-44(32-28-41)59(45-33-29-42(30-34-45)40-17-6-2-7-18-40)46-35-36-51-55(37-46)61-56-38-52(47-21-10-11-22-48(47)58(51)56)49-24-14-26-54-57(49)50-23-12-13-25-53(50)60(54)43-19-8-3-9-20-43/h1-38H/i1D,4D,5D,15D,16D,27D,28D,31D,32D |
| InChIKey | GXNFAYCNLKYAGP-MUVXGNGJSA-N |
| XLogP | 16.31 |
| TPSA | 21.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.01 |
| LogP ≤ 5 | 16.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |