C21H39N3O — CID 176797082
[4-(4-propan-2-ylcyclohexyl)piperazin-1-yl]-[(3S)-3-propan-2-ylpyrrolidin-1-yl]methanone (PubChem CID 176797082) has the molecular formula C21H39N3O and a molecular weight of 349.56 g/mol. Its IUPAC name is [4-(4-propan-2-ylcyclohexyl)piperazin-1-yl]-[(3S)-3-propan-2-ylpyrrolidin-1-yl]methanone.
| Compound Name | [4-(4-propan-2-ylcyclohexyl)piperazin-1-yl]-[(3S)-3-propan-2-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 176797082 |
| Molecular Formula | C21H39N3O |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.31 |
| IUPAC Name | [4-(4-propan-2-ylcyclohexyl)piperazin-1-yl]-[(3S)-3-propan-2-ylpyrrolidin-1-yl]methanone |
| SMILES | CC(C)C1CCC(N2CCN(C(=O)N3CC[C@@H](C(C)C)C3)CC2)CC1 |
| InChI | InChI=1S/C21H39N3O/c1-16(2)18-5-7-20(8-6-18)22-11-13-23(14-12-22)21(25)24-10-9-19(15-24)17(3)4/h16-20H,5-15H2,1-4H3/t18?,19-,20?/m1/s1 |
| InChIKey | GDNFBRBAUGDUSO-IOJLRTSASA-N |
| XLogP | 3.92 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |