C21H43N3O — CID 177134757
ethane;[4-(4-methylcyclohexyl)piperazin-1-yl]-[(3S)-3-methylpyrrolidin-1-yl]methanone (PubChem CID 177134757) has the molecular formula C21H43N3O and a molecular weight of 353.60 g/mol. Its IUPAC name is ethane;[4-(4-methylcyclohexyl)piperazin-1-yl]-[(3S)-3-methylpyrrolidin-1-yl]methanone.
| Compound Name | ethane;[4-(4-methylcyclohexyl)piperazin-1-yl]-[(3S)-3-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 177134757 |
| Molecular Formula | C21H43N3O |
| Molecular Weight | 353.60 g/mol |
| Exact Mass | 353.34 |
| IUPAC Name | ethane;[4-(4-methylcyclohexyl)piperazin-1-yl]-[(3S)-3-methylpyrrolidin-1-yl]methanone |
| SMILES | CC.CC.CC1CCC(N2CCN(C(=O)N3CC[C@H](C)C3)CC2)CC1 |
| InChI | InChI=1S/C17H31N3O.2C2H6/c1-14-3-5-16(6-4-14)18-9-11-19(12-10-18)17(21)20-8-7-15(2)13-20;2*1-2/h14-16H,3-13H2,1-2H3;2*1-2H3/t14?,15-,16?;;/m0../s1 |
| InChIKey | NRQNXVUPEBYRMI-NHBRVITKSA-N |
| XLogP | 4.70 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |