C14H24N2O4 — CID 176798329
tert-butyl N-[(2S)-1-cyanopropan-2-yl]-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]carbamate (PubChem CID 176798329) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-cyanopropan-2-yl]-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-cyanopropan-2-yl]-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 176798329 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-cyanopropan-2-yl]-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]carbamate |
| SMILES | C[C@@H](CC#N)N(CC1(CO)COC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O4/c1-11(5-6-15)16(12(18)20-13(2,3)4)7-14(8-17)9-19-10-14/h11,17H,5,7-10H2,1-4H3/t11-/m0/s1 |
| InChIKey | AJJQRFTYQBJYJP-NSHDSACASA-N |
| XLogP | 1.53 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |