C31H42N2O8 — CID 176799213
1-[[[(1R)-1-(4-acetyl-3,5-diethoxyphenyl)ethyl]-(2-phenylmethoxyethyl)carbamoyl]amino]-3-ethoxycyclobutane-1-carboxylic acid (PubChem CID 176799213) has the molecular formula C31H42N2O8 and a molecular weight of 570.68 g/mol. Its IUPAC name is 1-[[[(1R)-1-(4-acetyl-3,5-diethoxyphenyl)ethyl]-(2-phenylmethoxyethyl)carbamoyl]amino]-3-ethoxycyclobutane-1-carboxylic acid.
| Compound Name | 1-[[[(1R)-1-(4-acetyl-3,5-diethoxyphenyl)ethyl]-(2-phenylmethoxyethyl)carbamoyl]amino]-3-ethoxycyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 176799213 |
| Molecular Formula | C31H42N2O8 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 1-[[[(1R)-1-(4-acetyl-3,5-diethoxyphenyl)ethyl]-(2-phenylmethoxyethyl)carbamoyl]amino]-3-ethoxycyclobutane-1-carboxylic acid |
| SMILES | CCOc1cc([C@@H](C)N(CCOCc2ccccc2)C(=O)NC2(C(=O)O)CC(OCC)C2)cc(OCC)c1C(C)=O |
| InChI | InChI=1S/C31H42N2O8/c1-6-39-25-18-31(19-25,29(35)36)32-30(37)33(14-15-38-20-23-12-10-9-11-13-23)21(4)24-16-26(40-7-2)28(22(5)34)27(17-24)41-8-3/h9-13,16-17,21,25H,6-8,14-15,18-20H2,1-5H3,(H,32,37)(H,35,36)/t21-,25?,31?/m1/s1 |
| InChIKey | FXBHFIDFDYCDFY-AGRBXUFGSA-N |
| XLogP | 5.00 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|