C32H46N2O6 — CID 176799236
1-[[[(1R)-1-(3,5-diethoxy-4-methylphenyl)ethyl]-(4-phenylbutyl)carbamoyl]amino]-3-propan-2-yloxycyclobutane-1-carboxylic acid (PubChem CID 176799236) has the molecular formula C32H46N2O6 and a molecular weight of 554.73 g/mol. Its IUPAC name is 1-[[[(1R)-1-(3,5-diethoxy-4-methylphenyl)ethyl]-(4-phenylbutyl)carbamoyl]amino]-3-propan-2-yloxycyclobutane-1-carboxylic acid.
| Compound Name | 1-[[[(1R)-1-(3,5-diethoxy-4-methylphenyl)ethyl]-(4-phenylbutyl)carbamoyl]amino]-3-propan-2-yloxycyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 176799236 |
| Molecular Formula | C32H46N2O6 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | 1-[[[(1R)-1-(3,5-diethoxy-4-methylphenyl)ethyl]-(4-phenylbutyl)carbamoyl]amino]-3-propan-2-yloxycyclobutane-1-carboxylic acid |
| SMILES | CCOc1cc([C@@H](C)N(CCCCc2ccccc2)C(=O)NC2(C(=O)O)CC(OC(C)C)C2)cc(OCC)c1C |
| InChI | InChI=1S/C32H46N2O6/c1-7-38-28-18-26(19-29(23(28)5)39-8-2)24(6)34(17-13-12-16-25-14-10-9-11-15-25)31(37)33-32(30(35)36)20-27(21-32)40-22(3)4/h9-11,14-15,18-19,22,24,27H,7-8,12-13,16-17,20-21H2,1-6H3,(H,33,37)(H,35,36)/t24-,27?,32?/m1/s1 |
| InChIKey | LMUNNJPABXKALT-JQFBHHMMSA-N |
| XLogP | 6.30 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|