C30H42N6O3 — CID 176799308
1-[1-(3,5-diethoxy-4-methylphenyl)ethyl]-1-(4-phenylbutyl)-3-[1-(2H-tetrazol-5-yl)cyclopentyl]urea (PubChem CID 176799308) has the molecular formula C30H42N6O3 and a molecular weight of 534.71 g/mol. Its IUPAC name is 1-[1-(3,5-diethoxy-4-methylphenyl)ethyl]-1-(4-phenylbutyl)-3-[1-(2H-tetrazol-5-yl)cyclopentyl]urea.
| Compound Name | 1-[1-(3,5-diethoxy-4-methylphenyl)ethyl]-1-(4-phenylbutyl)-3-[1-(2H-tetrazol-5-yl)cyclopentyl]urea |
|---|---|
| PubChem CID | 176799308 |
| Molecular Formula | C30H42N6O3 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | 1-[1-(3,5-diethoxy-4-methylphenyl)ethyl]-1-(4-phenylbutyl)-3-[1-(2H-tetrazol-5-yl)cyclopentyl]urea |
| SMILES | CCOc1cc(C(C)N(CCCCc2ccccc2)C(=O)NC2(c3nn[nH]n3)CCCC2)cc(OCC)c1C |
| InChI | InChI=1S/C30H42N6O3/c1-5-38-26-20-25(21-27(22(26)3)39-6-2)23(4)36(19-13-10-16-24-14-8-7-9-15-24)29(37)31-30(17-11-12-18-30)28-32-34-35-33-28/h7-9,14-15,20-21,23H,5-6,10-13,16-19H2,1-4H3,(H,31,37)(H,32,33,34,35) |
| InChIKey | NCTMKEVGTYXWSR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|