C30H38F2N6O4 — CID 163405656
3-[(1R)-1-(4-acetyl-3,5-diethoxyphenyl)ethyl]-1-[3,3-difluoro-1-(2H-tetrazol-5-yl)cyclobutyl]-1-(4-phenylbutyl)urea (PubChem CID 163405656) has the molecular formula C30H38F2N6O4 and a molecular weight of 584.67 g/mol. Its IUPAC name is 3-[(1R)-1-(4-acetyl-3,5-diethoxyphenyl)ethyl]-1-[3,3-difluoro-1-(2H-tetrazol-5-yl)cyclobutyl]-1-(4-phenylbutyl)urea.
| Compound Name | 3-[(1R)-1-(4-acetyl-3,5-diethoxyphenyl)ethyl]-1-[3,3-difluoro-1-(2H-tetrazol-5-yl)cyclobutyl]-1-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 163405656 |
| Molecular Formula | C30H38F2N6O4 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 3-[(1R)-1-(4-acetyl-3,5-diethoxyphenyl)ethyl]-1-[3,3-difluoro-1-(2H-tetrazol-5-yl)cyclobutyl]-1-(4-phenylbutyl)urea |
| SMILES | CCOc1cc([C@@H](C)NC(=O)N(CCCCc2ccccc2)C2(c3nn[nH]n3)CC(F)(F)C2)cc(OCC)c1C(C)=O |
| InChI | InChI=1S/C30H38F2N6O4/c1-5-41-24-16-23(17-25(42-6-2)26(24)21(4)39)20(3)33-28(40)38(15-11-10-14-22-12-8-7-9-13-22)29(18-30(31,32)19-29)27-34-36-37-35-27/h7-9,12-13,16-17,20H,5-6,10-11,14-15,18-19H2,1-4H3,(H,33,40)(H,34,35,36,37)/t20-/m1/s1 |
| InChIKey | RFMXOXYFCYKSGO-HXUWFJFHSA-N |
| XLogP | 5.62 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|