C24H32N2O4 — CID 167095993
1-[(4-acetyl-3,5-diethoxyphenyl)methyl]-1-(4-phenylbutyl)urea (PubChem CID 167095993) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-[(4-acetyl-3,5-diethoxyphenyl)methyl]-1-(4-phenylbutyl)urea.
| Compound Name | 1-[(4-acetyl-3,5-diethoxyphenyl)methyl]-1-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 167095993 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1-[(4-acetyl-3,5-diethoxyphenyl)methyl]-1-(4-phenylbutyl)urea |
| SMILES | CCOc1cc(CN(CCCCc2ccccc2)C(N)=O)cc(OCC)c1C(C)=O |
| InChI | InChI=1S/C24H32N2O4/c1-4-29-21-15-20(16-22(30-5-2)23(21)18(3)27)17-26(24(25)28)14-10-9-13-19-11-7-6-8-12-19/h6-8,11-12,15-16H,4-5,9-10,13-14,17H2,1-3H3,(H2,25,28) |
| InChIKey | JVIDRGLJRVDOMV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|