C24H32N2O5 — CID 167095989
1-[(4-acetyl-3,5-diethoxy-2-methylphenyl)methyl]-1-(2-phenylmethoxyethyl)urea (PubChem CID 167095989) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-[(4-acetyl-3,5-diethoxy-2-methylphenyl)methyl]-1-(2-phenylmethoxyethyl)urea.
| Compound Name | 1-[(4-acetyl-3,5-diethoxy-2-methylphenyl)methyl]-1-(2-phenylmethoxyethyl)urea |
|---|---|
| PubChem CID | 167095989 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-[(4-acetyl-3,5-diethoxy-2-methylphenyl)methyl]-1-(2-phenylmethoxyethyl)urea |
| SMILES | CCOc1cc(CN(CCOCc2ccccc2)C(N)=O)c(C)c(OCC)c1C(C)=O |
| InChI | InChI=1S/C24H32N2O5/c1-5-30-21-14-20(17(3)23(31-6-2)22(21)18(4)27)15-26(24(25)28)12-13-29-16-19-10-8-7-9-11-19/h7-11,14H,5-6,12-13,15-16H2,1-4H3,(H2,25,28) |
| InChIKey | SWVGBPCNESVUGQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|