C24H34ClNO3 — CID 175217360
1-[2,6-diethoxy-4-[1-(4-phenylbutylamino)ethyl]phenyl]ethanone;hydrochloride (PubChem CID 175217360) has the molecular formula C24H34ClNO3 and a molecular weight of 419.99 g/mol. Its IUPAC name is 1-[2,6-diethoxy-4-[1-(4-phenylbutylamino)ethyl]phenyl]ethanone;hydrochloride.
| Compound Name | 1-[2,6-diethoxy-4-[1-(4-phenylbutylamino)ethyl]phenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 175217360 |
| Molecular Formula | C24H34ClNO3 |
| Molecular Weight | 419.99 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-[2,6-diethoxy-4-[1-(4-phenylbutylamino)ethyl]phenyl]ethanone;hydrochloride |
| SMILES | CCOc1cc(C(C)NCCCCc2ccccc2)cc(OCC)c1C(C)=O.Cl |
| InChI | InChI=1S/C24H33NO3.ClH/c1-5-27-22-16-21(17-23(28-6-2)24(22)19(4)26)18(3)25-15-11-10-14-20-12-8-7-9-13-20;/h7-9,12-13,16-18,25H,5-6,10-11,14-15H2,1-4H3;1H |
| InChIKey | WWZGWHHALZISIU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.99 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|