C30H40F2N6O4 — CID 175217333
1-[1-[3,5-diethoxy-4-(1-hydroxyethyl)phenyl]ethyl]-3-[3,3-difluoro-1-(2H-tetrazol-5-yl)cyclobutyl]-1-(4-phenylbutyl)urea (PubChem CID 175217333) has the molecular formula C30H40F2N6O4 and a molecular weight of 586.68 g/mol. Its IUPAC name is 1-[1-[3,5-diethoxy-4-(1-hydroxyethyl)phenyl]ethyl]-3-[3,3-difluoro-1-(2H-tetrazol-5-yl)cyclobutyl]-1-(4-phenylbutyl)urea.
| Compound Name | 1-[1-[3,5-diethoxy-4-(1-hydroxyethyl)phenyl]ethyl]-3-[3,3-difluoro-1-(2H-tetrazol-5-yl)cyclobutyl]-1-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 175217333 |
| Molecular Formula | C30H40F2N6O4 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | 1-[1-[3,5-diethoxy-4-(1-hydroxyethyl)phenyl]ethyl]-3-[3,3-difluoro-1-(2H-tetrazol-5-yl)cyclobutyl]-1-(4-phenylbutyl)urea |
| SMILES | CCOc1cc(C(C)N(CCCCc2ccccc2)C(=O)NC2(c3nn[nH]n3)CC(F)(F)C2)cc(OCC)c1C(C)O |
| InChI | InChI=1S/C30H40F2N6O4/c1-5-41-24-16-23(17-25(42-6-2)26(24)21(4)39)20(3)38(15-11-10-14-22-12-8-7-9-13-22)28(40)33-29(18-30(31,32)19-29)27-34-36-37-35-27/h7-9,12-13,16-17,20-21,39H,5-6,10-11,14-15,18-19H2,1-4H3,(H,33,40)(H,34,35,36,37) |
| InChIKey | DSOBPLGPJSSCGW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|