C30H42N2O5 — CID 176799233
(1S)-2-[[1-(3,5-diethoxy-4-methylphenyl)ethyl-(4-phenylbutyl)carbamoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 176799233) has the molecular formula C30H42N2O5 and a molecular weight of 510.68 g/mol. Its IUPAC name is (1S)-2-[[1-(3,5-diethoxy-4-methylphenyl)ethyl-(4-phenylbutyl)carbamoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | (1S)-2-[[1-(3,5-diethoxy-4-methylphenyl)ethyl-(4-phenylbutyl)carbamoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 176799233 |
| Molecular Formula | C30H42N2O5 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | (1S)-2-[[1-(3,5-diethoxy-4-methylphenyl)ethyl-(4-phenylbutyl)carbamoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | CCOc1cc(C(C)N(CCCCc2ccccc2)C(=O)NC2CCC[C@@H]2C(=O)O)cc(OCC)c1C |
| InChI | InChI=1S/C30H42N2O5/c1-5-36-27-19-24(20-28(21(27)3)37-6-2)22(4)32(18-11-10-15-23-13-8-7-9-14-23)30(35)31-26-17-12-16-25(26)29(33)34/h7-9,13-14,19-20,22,25-26H,5-6,10-12,15-18H2,1-4H3,(H,31,35)(H,33,34)/t22?,25-,26?/m0/s1 |
| InChIKey | YEIVNJKTWCUBNQ-FQHXLYSSSA-N |
| XLogP | 6.14 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|