C22H31FN2O3 — CID 176799798
benzyl 4-[[3-fluoro-1-(2-oxopentyl)azetidin-3-yl]methyl]piperidine-1-carboxylate (PubChem CID 176799798) has the molecular formula C22H31FN2O3 and a molecular weight of 390.50 g/mol. Its IUPAC name is benzyl 4-[[3-fluoro-1-(2-oxopentyl)azetidin-3-yl]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[3-fluoro-1-(2-oxopentyl)azetidin-3-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176799798 |
| Molecular Formula | C22H31FN2O3 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | benzyl 4-[[3-fluoro-1-(2-oxopentyl)azetidin-3-yl]methyl]piperidine-1-carboxylate |
| SMILES | CCCC(=O)CN1CC(F)(CC2CCN(C(=O)OCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C22H31FN2O3/c1-2-6-20(26)14-24-16-22(23,17-24)13-18-9-11-25(12-10-18)21(27)28-15-19-7-4-3-5-8-19/h3-5,7-8,18H,2,6,9-17H2,1H3 |
| InChIKey | KLOPPLSOMIUKAR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |