About 3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane
3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane (PubChem CID 176800760) has the molecular formula C11H18FN
and a molecular weight of 183.27 g/mol. Its IUPAC name is 3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane.
Analyze 3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane?
The IUPAC name of 3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane (CID 176800760) is 3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane.
What is the SMILES notation for 3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane?
The canonical SMILES for 3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane is CC(C)C12CCCN1C1C(F)C1C2.
What is the InChIKey of 3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane?
The InChIKey is DXNWEDQVZPZIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FN/c1-7(2)11-4-3-5-13(11)10-8(6-11)9(10)12/h7-10H,3-6H2,1-2H3.
What are the key properties of 3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane?
3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane has a molecular weight of 183.27 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6-propan-2-yl-1-azatricyclo[4.3.0.02,4]nonane is sourced from PubChem (CID 176800760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).