C12H24FNO — CID 177009819
(2R,8S)-8-(1-ethoxyethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine;methane (PubChem CID 177009819) has the molecular formula C12H24FNO and a molecular weight of 217.33 g/mol. Its IUPAC name is (2R,8S)-8-(1-ethoxyethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine;methane.
| Compound Name | (2R,8S)-8-(1-ethoxyethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine;methane |
|---|---|
| PubChem CID | 177009819 |
| Molecular Formula | C12H24FNO |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (2R,8S)-8-(1-ethoxyethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine;methane |
| SMILES | C.CCOC(C)[C@@]12CCCN1C[C@H](F)C2 |
| InChI | InChI=1S/C11H20FNO.CH4/c1-3-14-9(2)11-5-4-6-13(11)8-10(12)7-11;/h9-10H,3-8H2,1-2H3;1H4/t9?,10-,11+;/m1./s1 |
| InChIKey | QNCVZAJKBOGEEI-LLRQXEEASA-N |
| XLogP | 2.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |