C11H18FNO — CID 176804032
N-(2-fluorospiro[2.3]hexan-5-yl)-3-methylbutanamide (PubChem CID 176804032) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is N-(2-fluorospiro[2.3]hexan-5-yl)-3-methylbutanamide.
| Compound Name | N-(2-fluorospiro[2.3]hexan-5-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 176804032 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-(2-fluorospiro[2.3]hexan-5-yl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC1CC2(C1)CC2F |
| InChI | InChI=1S/C11H18FNO/c1-7(2)3-10(14)13-8-4-11(5-8)6-9(11)12/h7-9H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | UQYDZQXKWKALEC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |