C15H19N3O3 — CID 176805973
tert-butyl (3S,4R)-3-isocyano-4-(2-oxo-1H-pyridin-4-yl)pyrrolidine-1-carboxylate (PubChem CID 176805973) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-isocyano-4-(2-oxo-1H-pyridin-4-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-isocyano-4-(2-oxo-1H-pyridin-4-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 176805973 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | tert-butyl (3S,4R)-3-isocyano-4-(2-oxo-1H-pyridin-4-yl)pyrrolidine-1-carboxylate |
| SMILES | [C-]#[N+][C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-15(2,3)21-14(20)18-8-11(12(9-18)16-4)10-5-6-17-13(19)7-10/h5-7,11-12H,8-9H2,1-3H3,(H,17,19)/t11-,12+/m0/s1 |
| InChIKey | ZBDVWRAXCJYZPT-NWDGAFQWSA-N |
| XLogP | 2.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|