C24H36N5O6P — CID 176808512
3-[3-[1-[5-[(4-hexyltriazol-1-yl)methyl]-2-nitrophenyl]ethoxymethoxy]propoxyphosphanyloxy]propanenitrile (PubChem CID 176808512) has the molecular formula C24H36N5O6P and a molecular weight of 521.56 g/mol. Its IUPAC name is 3-[3-[1-[5-[(4-hexyltriazol-1-yl)methyl]-2-nitrophenyl]ethoxymethoxy]propoxyphosphanyloxy]propanenitrile.
| Compound Name | 3-[3-[1-[5-[(4-hexyltriazol-1-yl)methyl]-2-nitrophenyl]ethoxymethoxy]propoxyphosphanyloxy]propanenitrile |
|---|---|
| PubChem CID | 176808512 |
| Molecular Formula | C24H36N5O6P |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 3-[3-[1-[5-[(4-hexyltriazol-1-yl)methyl]-2-nitrophenyl]ethoxymethoxy]propoxyphosphanyloxy]propanenitrile |
| SMILES | CCCCCCc1cn(Cc2ccc([N+](=O)[O-])c(C(C)OCOCCCOPOCCC#N)c2)nn1 |
| InChI | InChI=1S/C24H36N5O6P/c1-3-4-5-6-9-22-18-28(27-26-22)17-21-10-11-24(29(30)31)23(16-21)20(2)33-19-32-13-8-15-35-36-34-14-7-12-25/h10-11,16,18,20,36H,3-9,13-15,17,19H2,1-2H3 |
| InChIKey | CKVNZZCXAAAKQA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 134.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|