C53H101NO5 — CID 176810769
7-[3-hydroxypropyl-[7-[(E)-3-pentyltridec-2-enoyl]oxyheptyl]amino]heptyl (E)-3-pentyltridec-2-enoate (PubChem CID 176810769) has the molecular formula C53H101NO5 and a molecular weight of 832.39 g/mol. Its IUPAC name is 7-[3-hydroxypropyl-[7-[(E)-3-pentyltridec-2-enoyl]oxyheptyl]amino]heptyl (E)-3-pentyltridec-2-enoate.
| Compound Name | 7-[3-hydroxypropyl-[7-[(E)-3-pentyltridec-2-enoyl]oxyheptyl]amino]heptyl (E)-3-pentyltridec-2-enoate |
|---|---|
| PubChem CID | 176810769 |
| Molecular Formula | C53H101NO5 |
| Molecular Weight | 832.39 g/mol |
| Exact Mass | 831.77 |
| IUPAC Name | 7-[3-hydroxypropyl-[7-[(E)-3-pentyltridec-2-enoyl]oxyheptyl]amino]heptyl (E)-3-pentyltridec-2-enoate |
| SMILES | CCCCCCCCCC/C(=C/C(=O)OCCCCCCCN(CCCO)CCCCCCCOC(=O)/C=C(\CCCCC)CCCCCCCCCC)CCCCC |
| InChI | InChI=1S/C53H101NO5/c1-5-9-13-15-17-19-23-31-40-50(38-29-11-7-3)48-52(56)58-46-35-27-21-25-33-42-54(44-37-45-55)43-34-26-22-28-36-47-59-53(57)49-51(39-30-12-8-4)41-32-24-20-18-16-14-10-6-2/h48-49,55H,5-47H2,1-4H3/b50-48+,51-49+ |
| InChIKey | GYLNQTOEALBUBK-BSLTZQBWSA-N |
| XLogP | 15.73 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.39 |
| LogP ≤ 5 | 15.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|