C13H19F3N4O — CID 176811311
2-methyl-1-[4-[3-methyl-5-(trifluoromethyl)imidazol-4-yl]piperazin-1-yl]propan-1-one (PubChem CID 176811311) has the molecular formula C13H19F3N4O and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-methyl-1-[4-[3-methyl-5-(trifluoromethyl)imidazol-4-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 2-methyl-1-[4-[3-methyl-5-(trifluoromethyl)imidazol-4-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 176811311 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-methyl-1-[4-[3-methyl-5-(trifluoromethyl)imidazol-4-yl]piperazin-1-yl]propan-1-one |
| SMILES | CC(C)C(=O)N1CCN(c2c(C(F)(F)F)ncn2C)CC1 |
| InChI | InChI=1S/C13H19F3N4O/c1-9(2)12(21)20-6-4-19(5-7-20)11-10(13(14,15)16)17-8-18(11)3/h8-9H,4-7H2,1-3H3 |
| InChIKey | KXCWRKLIKDODFV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |