C23H18FN3O6 — CID 176814637
(10S,23Z)-10-ethyl-18-fluoro-10,19-dihydroxy-23-hydroxyimino-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione (PubChem CID 176814637) has the molecular formula C23H18FN3O6 and a molecular weight of 451.41 g/mol. Its IUPAC name is (10S,23Z)-10-ethyl-18-fluoro-10,19-dihydroxy-23-hydroxyimino-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione.
| Compound Name | (10S,23Z)-10-ethyl-18-fluoro-10,19-dihydroxy-23-hydroxyimino-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione |
|---|---|
| PubChem CID | 176814637 |
| Molecular Formula | C23H18FN3O6 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | (10S,23Z)-10-ethyl-18-fluoro-10,19-dihydroxy-23-hydroxyimino-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(O)c3c1c2/C(=N\O)CC3 |
| InChI | InChI=1S/C23H18FN3O6/c1-2-23(31)12-5-16-19-10(7-27(16)21(29)11(12)8-33-22(23)30)18-14(26-32)4-3-9-17(18)15(25-19)6-13(24)20(9)28/h5-6,28,31-32H,2-4,7-8H2,1H3/b26-14-/t23-/m0/s1 |
| InChIKey | GIOXLKLATZSKQY-KLNAUVTNSA-N |
| XLogP | 2.05 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|