C23H27IN8 — CID 176815749
(Z)-2-[amino-[[6-[(cyclobutylmethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methyl]amino]-1-(6-iodo-1H-indazol-4-yl)ethenamine (PubChem CID 176815749) has the molecular formula C23H27IN8 and a molecular weight of 542.43 g/mol. Its IUPAC name is (Z)-2-[amino-[[6-[(cyclobutylmethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methyl]amino]-1-(6-iodo-1H-indazol-4-yl)ethenamine.
| Compound Name | (Z)-2-[amino-[[6-[(cyclobutylmethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methyl]amino]-1-(6-iodo-1H-indazol-4-yl)ethenamine |
|---|---|
| PubChem CID | 176815749 |
| Molecular Formula | C23H27IN8 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | (Z)-2-[amino-[[6-[(cyclobutylmethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methyl]amino]-1-(6-iodo-1H-indazol-4-yl)ethenamine |
| SMILES | N/C(=C\N(N)Cc1cn2cc(CNCC3CCC3)ccc2n1)c1cc(I)cc2[nH]ncc12 |
| InChI | InChI=1S/C23H27IN8/c24-17-6-19(20-10-28-30-22(20)7-17)21(25)14-32(26)13-18-12-31-11-16(4-5-23(31)29-18)9-27-8-15-2-1-3-15/h4-7,10-12,14-15,27H,1-3,8-9,13,25-26H2,(H,28,30)/b21-14- |
| InChIKey | ZHYUMJOUOSJWLV-STZFKDTASA-N |
| XLogP | 3.34 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|