C24H46NNaO6 — CID 176816204
sodium 9-[2-[carboxylatomethyl(dimethyl)azaniumyl]ethoxy]-10-hydroxyoctadecanoate (PubChem CID 176816204) has the molecular formula C24H46NNaO6 and a molecular weight of 467.62 g/mol. Its IUPAC name is sodium 9-[2-[carboxylatomethyl(dimethyl)azaniumyl]ethoxy]-10-hydroxyoctadecanoate.
| Compound Name | sodium 9-[2-[carboxylatomethyl(dimethyl)azaniumyl]ethoxy]-10-hydroxyoctadecanoate |
|---|---|
| PubChem CID | 176816204 |
| Molecular Formula | C24H46NNaO6 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.32 |
| IUPAC Name | sodium 9-[2-[carboxylatomethyl(dimethyl)azaniumyl]ethoxy]-10-hydroxyoctadecanoate |
| SMILES | CCCCCCCCC(O)C(CCCCCCCC(=O)[O-])OCC[N+](C)(C)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C24H47NO6.Na/c1-4-5-6-7-9-12-15-21(26)22(16-13-10-8-11-14-17-23(27)28)31-19-18-25(2,3)20-24(29)30;/h21-22,26H,4-20H2,1-3H3,(H-,27,28,29,30);/q;+1/p-1 |
| InChIKey | FVUURJSXPCUSKT-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|