C26H25N5O8S2 — CID 176816831
(2S)-2-[[5-[benzenesulfonamido-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]thiophene-2-carbonyl]amino]pentanedioic acid (PubChem CID 176816831) has the molecular formula C26H25N5O8S2 and a molecular weight of 599.65 g/mol. Its IUPAC name is (2S)-2-[[5-[benzenesulfonamido-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]thiophene-2-carbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[5-[benzenesulfonamido-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]thiophene-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 176816831 |
| Molecular Formula | C26H25N5O8S2 |
| Molecular Weight | 599.65 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | (2S)-2-[[5-[benzenesulfonamido-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]thiophene-2-carbonyl]amino]pentanedioic acid |
| SMILES | Cc1nc2ccc(CN(NS(=O)(=O)c3ccccc3)c3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)s3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C26H25N5O8S2/c1-15-27-19-8-7-16(13-18(19)24(34)28-15)14-31(30-41(38,39)17-5-3-2-4-6-17)22-11-10-21(40-22)25(35)29-20(26(36)37)9-12-23(32)33/h2-8,10-11,13,20,30H,9,12,14H2,1H3,(H,29,35)(H,32,33)(H,36,37)(H,27,28,34)/t20-/m0/s1 |
| InChIKey | ZRRKDPUZRORECZ-FQEVSTJZSA-N |
| XLogP | 2.24 |
| TPSA | 198.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.65 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|