C60H49IrN5O2-2 — CID 176817504
CID 176817504 (PubChem CID 176817504) has the molecular formula C60H49IrN5O2-2 and a molecular weight of 1064.30 g/mol.
| Compound Name | CID 176817504 |
|---|---|
| PubChem CID | 176817504 |
| Molecular Formula | C60H49IrN5O2-2 |
| Molecular Weight | 1064.30 g/mol |
| Exact Mass | 1064.35 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cccc2)n1.CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc4c(nc23)oc2ccccc24)nc2ccc3ccccc3c21.[Ir] |
| InChI | InChI=1S/C46H34N3O2.C14H15N2.Ir/c1-26(2)35-23-30(28-13-6-5-7-14-28)24-36(27(3)4)42(35)49-43-31-16-9-8-15-29(31)21-22-38(43)47-45(49)34-19-12-18-33-41-40(50-44(33)34)25-37-32-17-10-11-20-39(32)51-46(37)48-41;1-14(2,3)12-9-10-15-13(16-12)11-7-5-4-6-8-11;/h5-18,20-27H,1-4H3;4-7,9-10H,1-3H3;/q2*-1; |
| InChIKey | CFQKOAFVXTWWLS-UHFFFAOYSA-N |
| XLogP | 15.99 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1064.30 |
| LogP ≤ 5 | 15.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|