C32H22O6 — CID 176819824
2-[5-[10-(carboxymethoxy)phenanthren-4-yl]phenanthren-9-yl]oxyacetic acid (PubChem CID 176819824) has the molecular formula C32H22O6 and a molecular weight of 502.52 g/mol. Its IUPAC name is 2-[5-[10-(carboxymethoxy)phenanthren-4-yl]phenanthren-9-yl]oxyacetic acid.
| Compound Name | 2-[5-[10-(carboxymethoxy)phenanthren-4-yl]phenanthren-9-yl]oxyacetic acid |
|---|---|
| PubChem CID | 176819824 |
| Molecular Formula | C32H22O6 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 2-[5-[10-(carboxymethoxy)phenanthren-4-yl]phenanthren-9-yl]oxyacetic acid |
| SMILES | O=C(O)COc1cc2ccccc2c2c(-c3cccc4c(OCC(=O)O)cc5ccccc5c34)cccc12 |
| InChI | InChI=1S/C32H22O6/c33-29(34)17-37-27-15-19-7-1-3-9-21(19)31-23(11-5-13-25(27)31)24-12-6-14-26-28(38-18-30(35)36)16-20-8-2-4-10-22(20)32(24)26/h1-16H,17-18H2,(H,33,34)(H,35,36) |
| InChIKey | PYXODDSXWMFWKX-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|