C66H80BN3 — CID 176825821
4,18-ditert-butyl-N,N,8,14-tetrakis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,15(20),16,18-octaen-11-amine (PubChem CID 176825821) has the molecular formula C66H80BN3 and a molecular weight of 926.20 g/mol. Its IUPAC name is 4,18-ditert-butyl-N,N,8,14-tetrakis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,15(20),16,18-octaen-11-amine.
| Compound Name | 4,18-ditert-butyl-N,N,8,14-tetrakis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,15(20),16,18-octaen-11-amine |
|---|---|
| PubChem CID | 176825821 |
| Molecular Formula | C66H80BN3 |
| Molecular Weight | 926.20 g/mol |
| Exact Mass | 925.64 |
| IUPAC Name | 4,18-ditert-butyl-N,N,8,14-tetrakis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,15(20),16,18-octaen-11-amine |
| SMILES | CC(C)(C)c1ccc(N(C2=CC3C4B(c5cc(C(C)(C)C)ccc5N(c5ccc(C(C)(C)C)cc5)C4=C2)c2cc(C(C)(C)C)ccc2N3c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C66H80BN3/c1-61(2,3)43-19-29-49(30-20-43)68(50-31-21-44(22-32-50)62(4,5)6)53-41-58-60-59(42-53)70(52-35-25-46(26-36-52)64(10,11)12)57-38-28-48(66(16,17)18)40-55(57)67(60)54-39-47(65(13,14)15)27-37-56(54)69(58)51-33-23-45(24-34-51)63(7,8)9/h19-42,58,60H,1-18H3 |
| InChIKey | XFHNSZLMKZMZMY-UHFFFAOYSA-N |
| XLogP | 16.74 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.20 |
| LogP ≤ 5 | 16.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|